C31H32F3N5O6S — CID 87458798
1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-N-cyanoindole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87458798) has the molecular formula C31H32F3N5O6S and a molecular weight of 659.69 g/mol. Its IUPAC name is 1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-N-cyanoindole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-N-cyanoindole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87458798 |
| Molecular Formula | C31H32F3N5O6S |
| Molecular Weight | 659.69 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | 1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-N-cyanoindole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(CCn1ccc2cc(C(=O)NC#N)ccc21)NC[C@H](O)c1cccc(NS(=O)(=O)c2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H31N5O4S.C2HF3O2/c1-29(2,14-16-34-15-13-21-17-23(11-12-26(21)34)28(36)31-20-30)32-19-27(35)22-7-6-8-24(18-22)33-39(37,38)25-9-4-3-5-10-25;3-2(4,5)1(6)7/h3-13,15,17-18,27,32-33,35H,14,16,19H2,1-2H3,(H,31,36);(H,6,7)/t27-;/m0./s1 |
| InChIKey | MIOQHLZCLIFQHU-YCBFMBTMSA-N |
| XLogP | 4.78 |
| TPSA | 173.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|