C33H43N5O4S — CID 58875090
(2S)-2-amino-N-[1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]indol-5-yl]-3-methylpentanamide (PubChem CID 58875090) has the molecular formula C33H43N5O4S and a molecular weight of 605.81 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]indol-5-yl]-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]indol-5-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 58875090 |
| Molecular Formula | C33H43N5O4S |
| Molecular Weight | 605.81 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | (2S)-2-amino-N-[1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]indol-5-yl]-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1ccc2c(ccn2CCC(C)(C)NC[C@H](O)c2cccc(NS(=O)(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C33H43N5O4S/c1-5-23(2)31(34)32(40)36-26-14-15-29-24(20-26)16-18-38(29)19-17-33(3,4)35-22-30(39)25-10-9-11-27(21-25)37-43(41,42)28-12-7-6-8-13-28/h6-16,18,20-21,23,30-31,35,37,39H,5,17,19,22,34H2,1-4H3,(H,36,40)/t23?,30-,31-/m0/s1 |
| InChIKey | QMWRCAMTZKFDBW-UHQPWNTQSA-N |
| XLogP | 5.25 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |