C23H26N4O5 — CID 174550762
3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]-1,5-dihydro-1,2,4-triazole-5-carbaldehyde (PubChem CID 174550762) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]-1,5-dihydro-1,2,4-triazole-5-carbaldehyde.
| Compound Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]-1,5-dihydro-1,2,4-triazole-5-carbaldehyde |
|---|---|
| PubChem CID | 174550762 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]-1,5-dihydro-1,2,4-triazole-5-carbaldehyde |
| SMILES | CC(C)c1cc(C2=NNC(C=O)N2c2ccc(C(=O)N3CCOCC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C23H26N4O5/c1-14(2)17-11-18(20(30)12-19(17)29)22-25-24-21(13-28)27(22)16-5-3-15(4-6-16)23(31)26-7-9-32-10-8-26/h3-6,11-14,21,24,29-30H,7-10H2,1-2H3 |
| InChIKey | QJTKHQNTHCLDAZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|