C19H25N3O — CID 174552364
N-(4-butanimidoyl-2-methylquinolin-7-yl)-3-methylbutanamide (PubChem CID 174552364) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(4-butanimidoyl-2-methylquinolin-7-yl)-3-methylbutanamide.
| Compound Name | N-(4-butanimidoyl-2-methylquinolin-7-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 174552364 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-(4-butanimidoyl-2-methylquinolin-7-yl)-3-methylbutanamide |
| SMILES | [H]/N=C(\CCC)c1cc(C)nc2cc(NC(=O)CC(C)C)ccc12 |
| InChI | InChI=1S/C19H25N3O/c1-5-6-17(20)16-10-13(4)21-18-11-14(7-8-15(16)18)22-19(23)9-12(2)3/h7-8,10-12,20H,5-6,9H2,1-4H3,(H,22,23)/b20-17+ |
| InChIKey | GBPKUPPYRRYHBS-LVZFUZTISA-N |
| XLogP | 4.70 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|