C45H46N4O — CID 174423397
2,4-bis[4-(4-butanimidoyl-2-methylquinolin-7-yl)phenyl]pentan-3-one (PubChem CID 174423397) has the molecular formula C45H46N4O and a molecular weight of 658.89 g/mol. Its IUPAC name is 2,4-bis[4-(4-butanimidoyl-2-methylquinolin-7-yl)phenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-(4-butanimidoyl-2-methylquinolin-7-yl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174423397 |
| Molecular Formula | C45H46N4O |
| Molecular Weight | 658.89 g/mol |
| Exact Mass | 658.37 |
| IUPAC Name | 2,4-bis[4-(4-butanimidoyl-2-methylquinolin-7-yl)phenyl]pentan-3-one |
| SMILES | [H]/N=C(\CCC)c1cc(C)nc2cc(-c3ccc(C(C)C(=O)C(C)c4ccc(-c5ccc6c(/C(CCC)=N/[H])cc(C)nc6c5)cc4)cc3)ccc12 |
| InChI | InChI=1S/C45H46N4O/c1-7-9-41(46)39-23-27(3)48-43-25-35(19-21-37(39)43)33-15-11-31(12-16-33)29(5)45(50)30(6)32-13-17-34(18-14-32)36-20-22-38-40(42(47)10-8-2)24-28(4)49-44(38)26-36/h11-26,29-30,46-47H,7-10H2,1-6H3/b46-41+,47-42+ |
| InChIKey | OFHIDLQRSDOOMA-DKVNQICBSA-N |
| XLogP | 11.55 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.89 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|