C17H22ClIN2O — CID 174537830
(2S)-2-(ethoxymethyl)-1-(7-iodo-2-methylquinolin-4-yl)butan-1-imine;hydrochloride (PubChem CID 174537830) has the molecular formula C17H22ClIN2O and a molecular weight of 432.73 g/mol. Its IUPAC name is (2S)-2-(ethoxymethyl)-1-(7-iodo-2-methylquinolin-4-yl)butan-1-imine;hydrochloride.
| Compound Name | (2S)-2-(ethoxymethyl)-1-(7-iodo-2-methylquinolin-4-yl)butan-1-imine;hydrochloride |
|---|---|
| PubChem CID | 174537830 |
| Molecular Formula | C17H22ClIN2O |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (2S)-2-(ethoxymethyl)-1-(7-iodo-2-methylquinolin-4-yl)butan-1-imine;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1cc(C)nc2cc(I)ccc12)[C@H](CC)COCC |
| InChI | InChI=1S/C17H21IN2O.ClH/c1-4-12(10-21-5-2)17(19)15-8-11(3)20-16-9-13(18)6-7-14(15)16;/h6-9,12,19H,4-5,10H2,1-3H3;1H/b19-17+;/t12-;/m1./s1 |
| InChIKey | OIHXVNBAYSQASW-PPPPEEPRSA-N |
| XLogP | 5.00 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|