C22H22FN3O2 — CID 174552293
4-fluoro-N-[4-[(2S)-2-(hydroxymethyl)butanimidoyl]-2-methylquinolin-7-yl]benzamide (PubChem CID 174552293) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-fluoro-N-[4-[(2S)-2-(hydroxymethyl)butanimidoyl]-2-methylquinolin-7-yl]benzamide.
| Compound Name | 4-fluoro-N-[4-[(2S)-2-(hydroxymethyl)butanimidoyl]-2-methylquinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 174552293 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-fluoro-N-[4-[(2S)-2-(hydroxymethyl)butanimidoyl]-2-methylquinolin-7-yl]benzamide |
| SMILES | [H]/N=C(/c1cc(C)nc2cc(NC(=O)c3ccc(F)cc3)ccc12)[C@H](CC)CO |
| InChI | InChI=1S/C22H22FN3O2/c1-3-14(12-27)21(24)19-10-13(2)25-20-11-17(8-9-18(19)20)26-22(28)15-4-6-16(23)7-5-15/h4-11,14,24,27H,3,12H2,1-2H3,(H,26,28)/b24-21+/t14-/m1/s1 |
| InChIKey | VMHIFOVBTLRQEH-RNJOOVFYSA-N |
| XLogP | 4.32 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|