C22H24N2O2 — CID 175237300
1-[7-(2,4-dimethoxyphenyl)-2-methylquinolin-4-yl]butan-1-imine (PubChem CID 175237300) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[7-(2,4-dimethoxyphenyl)-2-methylquinolin-4-yl]butan-1-imine.
| Compound Name | 1-[7-(2,4-dimethoxyphenyl)-2-methylquinolin-4-yl]butan-1-imine |
|---|---|
| PubChem CID | 175237300 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[7-(2,4-dimethoxyphenyl)-2-methylquinolin-4-yl]butan-1-imine |
| SMILES | [H]/N=C(\CCC)c1cc(C)nc2cc(-c3ccc(OC)cc3OC)ccc12 |
| InChI | InChI=1S/C22H24N2O2/c1-5-6-20(23)19-11-14(2)24-21-12-15(7-9-18(19)21)17-10-8-16(25-3)13-22(17)26-4/h7-13,23H,5-6H2,1-4H3/b23-20+ |
| InChIKey | RTFKAZDGTHTYGJ-BSYVCWPDSA-N |
| XLogP | 5.40 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|