C24H34N6O2 — CID 174552646
2-(cyclohexylamino)-4-[2,6,6-tris(methylamino)-4-oxo-5,7-dihydroindol-1-yl]benzamide (PubChem CID 174552646) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-(cyclohexylamino)-4-[2,6,6-tris(methylamino)-4-oxo-5,7-dihydroindol-1-yl]benzamide.
| Compound Name | 2-(cyclohexylamino)-4-[2,6,6-tris(methylamino)-4-oxo-5,7-dihydroindol-1-yl]benzamide |
|---|---|
| PubChem CID | 174552646 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 2-(cyclohexylamino)-4-[2,6,6-tris(methylamino)-4-oxo-5,7-dihydroindol-1-yl]benzamide |
| SMILES | CNc1cc2c(n1-c1ccc(C(N)=O)c(NC3CCCCC3)c1)CC(NC)(NC)CC2=O |
| InChI | InChI=1S/C24H34N6O2/c1-26-22-12-18-20(13-24(27-2,28-3)14-21(18)31)30(22)16-9-10-17(23(25)32)19(11-16)29-15-7-5-4-6-8-15/h9-12,15,26-29H,4-8,13-14H2,1-3H3,(H2,25,32) |
| InChIKey | NWFZIXCPFIQKPE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|