C36H33O7P3 — CID 174553111
phosphono dihydrogen phosphate;tetraphenyl-(2-phenylphenyl)-λ5-phosphane (PubChem CID 174553111) has the molecular formula C36H33O7P3 and a molecular weight of 670.58 g/mol. Its IUPAC name is phosphono dihydrogen phosphate;tetraphenyl-(2-phenylphenyl)-λ5-phosphane.
| Compound Name | phosphono dihydrogen phosphate;tetraphenyl-(2-phenylphenyl)-λ5-phosphane |
|---|---|
| PubChem CID | 174553111 |
| Molecular Formula | C36H33O7P3 |
| Molecular Weight | 670.58 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | phosphono dihydrogen phosphate;tetraphenyl-(2-phenylphenyl)-λ5-phosphane |
| SMILES | O=P(O)(O)OP(=O)(O)O.c1ccc(-c2ccccc2P(c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H29P.H4O7P2/c1-6-18-30(19-7-1)35-28-16-17-29-36(35)37(31-20-8-2-9-21-31,32-22-10-3-11-23-32,33-24-12-4-13-25-33)34-26-14-5-15-27-34;1-8(2,3)7-9(4,5)6/h1-29H;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | MOMOWMJUQQBAIY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|