C11H20O11P2 — CID 159986378
2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol;phosphono dihydrogen phosphate (PubChem CID 159986378) has the molecular formula C11H20O11P2 and a molecular weight of 390.22 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol;phosphono dihydrogen phosphate.
| Compound Name | 2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 159986378 |
| Molecular Formula | C11H20O11P2 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.OCC(CO)(CO)C(O)c1ccccc1 |
| InChI | InChI=1S/C11H16O4.H4O7P2/c12-6-11(7-13,8-14)10(15)9-4-2-1-3-5-9;1-8(2,3)7-9(4,5)6/h1-5,10,12-15H,6-8H2;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | OGJRZUOGUNCDGF-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|