C26H40O10P2 — CID 88744745
[3-(2,6-ditert-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)-3-phenoxypropyl] phosphono hydrogen phosphate (PubChem CID 88744745) has the molecular formula C26H40O10P2 and a molecular weight of 574.54 g/mol. Its IUPAC name is [3-(2,6-ditert-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)-3-phenoxypropyl] phosphono hydrogen phosphate.
| Compound Name | [3-(2,6-ditert-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)-3-phenoxypropyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88744745 |
| Molecular Formula | C26H40O10P2 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [3-(2,6-ditert-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)-3-phenoxypropyl] phosphono hydrogen phosphate |
| SMILES | Cc1cc(C(C)(C)C)c(C(Oc2ccccc2)C(CO)(CO)COP(=O)(O)OP(=O)(O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H40O10P2/c1-18-13-20(24(2,3)4)22(21(14-18)25(5,6)7)23(35-19-11-9-8-10-12-19)26(15-27,16-28)17-34-38(32,33)36-37(29,30)31/h8-14,23,27-28H,15-17H2,1-7H3,(H,32,33)(H2,29,30,31) |
| InChIKey | VPXDNVRPDRZDRH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|