C33H54O10P2 — CID 88994830
[3-(2,6-ditert-butylphenoxy)-3-(2,6-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate (PubChem CID 88994830) has the molecular formula C33H54O10P2 and a molecular weight of 672.73 g/mol. Its IUPAC name is [3-(2,6-ditert-butylphenoxy)-3-(2,6-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate.
| Compound Name | [3-(2,6-ditert-butylphenoxy)-3-(2,6-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88994830 |
| Molecular Formula | C33H54O10P2 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | [3-(2,6-ditert-butylphenoxy)-3-(2,6-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OC(c1c(C(C)(C)C)cccc1C(C)(C)C)C(CO)(CO)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C33H54O10P2/c1-29(2,3)22-15-13-16-23(30(4,5)6)26(22)28(33(19-34,20-35)21-41-45(39,40)43-44(36,37)38)42-27-24(31(7,8)9)17-14-18-25(27)32(10,11)12/h13-18,28,34-35H,19-21H2,1-12H3,(H,39,40)(H2,36,37,38) |
| InChIKey | ROLMEKHXKZWFDV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|