C20H33NO7P2 — CID 102400522
[(2E,6E)-8-(2-tert-butylanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 102400522) has the molecular formula C20H33NO7P2 and a molecular weight of 461.43 g/mol. Its IUPAC name is [(2E,6E)-8-(2-tert-butylanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-8-(2-tert-butylanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 102400522 |
| Molecular Formula | C20H33NO7P2 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [(2E,6E)-8-(2-tert-butylanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CNc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C20H33NO7P2/c1-16(13-14-27-30(25,26)28-29(22,23)24)9-8-10-17(2)15-21-19-12-7-6-11-18(19)20(3,4)5/h6-7,10-13,21H,8-9,14-15H2,1-5H3,(H,25,26)(H2,22,23,24)/b16-13+,17-10+ |
| InChIKey | PRBJODKZULCWME-DQKQXWASSA-N |
| XLogP | 5.30 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|