C17H24F3NO8P2 — CID 102400525
[(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethoxy)anilino]octa-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 102400525) has the molecular formula C17H24F3NO8P2 and a molecular weight of 489.32 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethoxy)anilino]octa-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethoxy)anilino]octa-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 102400525 |
| Molecular Formula | C17H24F3NO8P2 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethoxy)anilino]octa-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CNc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3NO8P2/c1-13(9-10-27-31(25,26)29-30(22,23)24)5-3-6-14(2)12-21-15-7-4-8-16(11-15)28-17(18,19)20/h4,6-9,11,21H,3,5,10,12H2,1-2H3,(H,25,26)(H2,22,23,24)/b13-9+,14-6+ |
| InChIKey | HDAXGFSESGBCTE-WSPXSRFVSA-N |
| XLogP | 4.90 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|