C24H29NO9P2 — CID 10347039
[(2E,6E)-8-[(3-benzoylbenzoyl)amino]-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 10347039) has the molecular formula C24H29NO9P2 and a molecular weight of 537.44 g/mol. Its IUPAC name is [(2E,6E)-8-[(3-benzoylbenzoyl)amino]-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-8-[(3-benzoylbenzoyl)amino]-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10347039 |
| Molecular Formula | C24H29NO9P2 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | [(2E,6E)-8-[(3-benzoylbenzoyl)amino]-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CNC(=O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H29NO9P2/c1-18(14-15-33-36(31,32)34-35(28,29)30)8-6-9-19(2)17-25-24(27)22-13-7-12-21(16-22)23(26)20-10-4-3-5-11-20/h3-5,7,9-14,16H,6,8,15,17H2,1-2H3,(H,25,27)(H,31,32)(H2,28,29,30)/b18-14+,19-9+ |
| InChIKey | KNTXAVRHVYGJNW-KKEAHIQDSA-N |
| XLogP | 4.55 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|