C17H24NO7P2-3 — CID 123132251
[[(2E,6E)-3,7-dimethyl-8-(3-methylanilino)octa-2,6-dienoxy]-oxidophosphoryl] phosphate (PubChem CID 123132251) has the molecular formula C17H24NO7P2-3 and a molecular weight of 416.33 g/mol. Its IUPAC name is [[(2E,6E)-3,7-dimethyl-8-(3-methylanilino)octa-2,6-dienoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2E,6E)-3,7-dimethyl-8-(3-methylanilino)octa-2,6-dienoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 123132251 |
| Molecular Formula | C17H24NO7P2-3 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [[(2E,6E)-3,7-dimethyl-8-(3-methylanilino)octa-2,6-dienoxy]-oxidophosphoryl] phosphate |
| SMILES | C/C(=C\COP(=O)([O-])OP(=O)([O-])[O-])CC/C=C(\C)CNc1cccc(C)c1 |
| InChI | InChI=1S/C17H27NO7P2/c1-14(10-11-24-27(22,23)25-26(19,20)21)6-4-8-16(3)13-18-17-9-5-7-15(2)12-17/h5,7-10,12,18H,4,6,11,13H2,1-3H3,(H,22,23)(H2,19,20,21)/p-3/b14-10+,16-8+ |
| InChIKey | QRRBFUYCWVFUFG-DRJBUHLUSA-K |
| XLogP | 2.41 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|