C13H23O7P2-3 — CID 149426615
[[(2E,6E)-3,7-dimethylundeca-2,6-dienoxy]-oxidophosphoryl] phosphate (PubChem CID 149426615) has the molecular formula C13H23O7P2-3 and a molecular weight of 353.27 g/mol. Its IUPAC name is [[(2E,6E)-3,7-dimethylundeca-2,6-dienoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2E,6E)-3,7-dimethylundeca-2,6-dienoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 149426615 |
| Molecular Formula | C13H23O7P2-3 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [[(2E,6E)-3,7-dimethylundeca-2,6-dienoxy]-oxidophosphoryl] phosphate |
| SMILES | CCCC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C13H26O7P2/c1-4-5-7-12(2)8-6-9-13(3)10-11-19-22(17,18)20-21(14,15)16/h8,10H,4-7,9,11H2,1-3H3,(H,17,18)(H2,14,15,16)/p-3/b12-8+,13-10+ |
| InChIKey | YUFPEDGSYWMMBY-SDCOAONHSA-K |
| XLogP | 2.18 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|