C15H26O6P2S-2 — CID 56947069
[hydroxy(oxido)phosphinothioyl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate (PubChem CID 56947069) has the molecular formula C15H26O6P2S-2 and a molecular weight of 396.38 g/mol. Its IUPAC name is [hydroxy(oxido)phosphinothioyl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate.
| Compound Name | [hydroxy(oxido)phosphinothioyl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate |
|---|---|
| PubChem CID | 56947069 |
| Molecular Formula | C15H26O6P2S-2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [hydroxy(oxido)phosphinothioyl] 3,7,11-trimethyldodeca-2,6,10-trienyl phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP([O-])(O)=S |
| InChI | InChI=1S/C15H28O6P2S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-20-22(16,17)21-23(18,19)24/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,16,17)(H2,18,19,24)/p-2 |
| InChIKey | DRADWUUFBCYMDM-UHFFFAOYSA-L |
| XLogP | 3.48 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|