C17H24N2O7P2 — CID 87450190
[(2E,6E)-8-(3-cyanoanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 87450190) has the molecular formula C17H24N2O7P2 and a molecular weight of 430.33 g/mol. Its IUPAC name is [(2E,6E)-8-(3-cyanoanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-8-(3-cyanoanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87450190 |
| Molecular Formula | C17H24N2O7P2 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [(2E,6E)-8-(3-cyanoanilino)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CNc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H24N2O7P2/c1-14(9-10-25-28(23,24)26-27(20,21)22)5-3-6-15(2)13-19-17-8-4-7-16(11-17)12-18/h4,6-9,11,19H,3,5,10,13H2,1-2H3,(H,23,24)(H2,20,21,22)/b14-9+,15-6+ |
| InChIKey | RUHZHDWQVIDJTK-JFOHIDKFSA-N |
| XLogP | 3.87 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|