C13H32N2O10P2 — CID 22755389
[3-(diethylamino)-3-(diethylaminooxy)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate (PubChem CID 22755389) has the molecular formula C13H32N2O10P2 and a molecular weight of 438.35 g/mol. Its IUPAC name is [3-(diethylamino)-3-(diethylaminooxy)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate.
| Compound Name | [3-(diethylamino)-3-(diethylaminooxy)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 22755389 |
| Molecular Formula | C13H32N2O10P2 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [3-(diethylamino)-3-(diethylaminooxy)-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate |
| SMILES | CCN(CC)OC(N(CC)CC)C(CO)(CO)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H32N2O10P2/c1-5-14(6-2)12(24-15(7-3)8-4)13(9-16,10-17)11-23-27(21,22)25-26(18,19)20/h12,16-17H,5-11H2,1-4H3,(H,21,22)(H2,18,19,20) |
| InChIKey | WQCDWAUFRYKCCR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|