C7H19NO7P2 — CID 139908070
1-(diethylamino)propyl phosphono hydrogen phosphate (PubChem CID 139908070) has the molecular formula C7H19NO7P2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 1-(diethylamino)propyl phosphono hydrogen phosphate.
| Compound Name | 1-(diethylamino)propyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 139908070 |
| Molecular Formula | C7H19NO7P2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(diethylamino)propyl phosphono hydrogen phosphate |
| SMILES | CCC(OP(=O)(O)OP(=O)(O)O)N(CC)CC |
| InChI | InChI=1S/C7H19NO7P2/c1-4-7(8(5-2)6-3)14-17(12,13)15-16(9,10)11/h7H,4-6H2,1-3H3,(H,12,13)(H2,9,10,11) |
| InChIKey | NMQFRGKXCQIMBJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|