About 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol
4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol (PubChem CID 174553748) has the molecular formula C23H23FO3
and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol |
| PubChem CID | 174553748 |
| Molecular Formula | C23H23FO3 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(O)cc(C)c1Cc1ccc(O)c(C(O)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H23FO3/c1-14-9-19(25)10-15(2)20(14)11-17-5-8-22(26)21(12-17)23(27)13-16-3-6-18(24)7-4-16/h3-10,12,23,25-27H,11,13H2,1-2H3 |
| InChIKey | NCRFGNKDYLEVSM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol?
The IUPAC name of 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol (CID 174553748) is 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol.
What is the SMILES notation for 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol?
The canonical SMILES for 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol is Cc1cc(O)cc(C)c1Cc1ccc(O)c(C(O)Cc2ccc(F)cc2)c1.
What is the InChIKey of 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol?
The InChIKey is NCRFGNKDYLEVSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FO3/c1-14-9-19(25)10-15(2)20(14)11-17-5-8-22(26)21(12-17)23(27)13-16-3-6-18(24)7-4-16/h3-10,12,23,25-27H,11,13H2,1-2H3.
What are the key properties of 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol?
4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol has a molecular weight of 366.43 g/mol, XLogP of 4.72, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[2-(4-fluorophenyl)-1-hydroxyethyl]-4-hydroxyphenyl]methyl]-3,5-dimethylphenol is sourced from PubChem (CID 174553748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).