C13H16N2O7 — CID 174555937
methyl 2-(2,2-dimethoxyethylcarbamoyl)-4-nitrobenzoate (PubChem CID 174555937) has the molecular formula C13H16N2O7 and a molecular weight of 312.28 g/mol. Its IUPAC name is methyl 2-(2,2-dimethoxyethylcarbamoyl)-4-nitrobenzoate.
| Compound Name | methyl 2-(2,2-dimethoxyethylcarbamoyl)-4-nitrobenzoate |
|---|---|
| PubChem CID | 174555937 |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | methyl 2-(2,2-dimethoxyethylcarbamoyl)-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1C(=O)NCC(OC)OC |
| InChI | InChI=1S/C13H16N2O7/c1-20-11(21-2)7-14-12(16)10-6-8(15(18)19)4-5-9(10)13(17)22-3/h4-6,11H,7H2,1-3H3,(H,14,16) |
| InChIKey | REEZFSVYGADRMK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|