C11H15N3O2S — CID 174556107
4-anilino-3-formyl-4-sulfanylbutanehydrazide (PubChem CID 174556107) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-anilino-3-formyl-4-sulfanylbutanehydrazide.
| Compound Name | 4-anilino-3-formyl-4-sulfanylbutanehydrazide |
|---|---|
| PubChem CID | 174556107 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-anilino-3-formyl-4-sulfanylbutanehydrazide |
| SMILES | NNC(=O)CC(C=O)C(S)Nc1ccccc1 |
| InChI | InChI=1S/C11H15N3O2S/c12-14-10(16)6-8(7-15)11(17)13-9-4-2-1-3-5-9/h1-5,7-8,11,13,17H,6,12H2,(H,14,16) |
| InChIKey | VBKKVRXORFNLKQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|