C18H19N5O4S2 — CID 174556090
1-[(4-anilino-3-formyl-4-sulfanylbutanoyl)amino]-3-(4-nitrophenyl)thiourea (PubChem CID 174556090) has the molecular formula C18H19N5O4S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-[(4-anilino-3-formyl-4-sulfanylbutanoyl)amino]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(4-anilino-3-formyl-4-sulfanylbutanoyl)amino]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 174556090 |
| Molecular Formula | C18H19N5O4S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[(4-anilino-3-formyl-4-sulfanylbutanoyl)amino]-3-(4-nitrophenyl)thiourea |
| SMILES | O=CC(CC(=O)NNC(=S)Nc1ccc([N+](=O)[O-])cc1)C(S)Nc1ccccc1 |
| InChI | InChI=1S/C18H19N5O4S2/c24-11-12(17(28)19-13-4-2-1-3-5-13)10-16(25)21-22-18(29)20-14-6-8-15(9-7-14)23(26)27/h1-9,11-12,17,19,28H,10H2,(H,21,25)(H2,20,22,29) |
| InChIKey | RVANJHUZYQNUEB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|