C15H16BrN5O2S3 — CID 174556074
1-(4-bromophenyl)-3-[[3-formyl-4-sulfanyl-4-(1,3-thiazol-2-ylamino)butanoyl]amino]thiourea (PubChem CID 174556074) has the molecular formula C15H16BrN5O2S3 and a molecular weight of 474.43 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[[3-formyl-4-sulfanyl-4-(1,3-thiazol-2-ylamino)butanoyl]amino]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[[3-formyl-4-sulfanyl-4-(1,3-thiazol-2-ylamino)butanoyl]amino]thiourea |
|---|---|
| PubChem CID | 174556074 |
| Molecular Formula | C15H16BrN5O2S3 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 1-(4-bromophenyl)-3-[[3-formyl-4-sulfanyl-4-(1,3-thiazol-2-ylamino)butanoyl]amino]thiourea |
| SMILES | O=CC(CC(=O)NNC(=S)Nc1ccc(Br)cc1)C(S)Nc1nccs1 |
| InChI | InChI=1S/C15H16BrN5O2S3/c16-10-1-3-11(4-2-10)18-14(25)21-20-12(23)7-9(8-22)13(24)19-15-17-5-6-26-15/h1-6,8-9,13,24H,7H2,(H,17,19)(H,20,23)(H2,18,21,25) |
| InChIKey | SQRLCWGKRCTQRF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|