C18H20ClN5O5S3 — CID 174541612
[4-[[4-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-formyl-4-oxo-1-sulfanylbutyl]amino]phenyl]sulfamic acid (PubChem CID 174541612) has the molecular formula C18H20ClN5O5S3 and a molecular weight of 518.04 g/mol. Its IUPAC name is [4-[[4-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-formyl-4-oxo-1-sulfanylbutyl]amino]phenyl]sulfamic acid.
| Compound Name | [4-[[4-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-formyl-4-oxo-1-sulfanylbutyl]amino]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 174541612 |
| Molecular Formula | C18H20ClN5O5S3 |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | [4-[[4-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-formyl-4-oxo-1-sulfanylbutyl]amino]phenyl]sulfamic acid |
| SMILES | O=CC(CC(=O)NNC(=S)Nc1cccc(Cl)c1)C(S)Nc1ccc(NS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H20ClN5O5S3/c19-12-2-1-3-15(9-12)21-18(31)23-22-16(26)8-11(10-25)17(30)20-13-4-6-14(7-5-13)24-32(27,28)29/h1-7,9-11,17,20,24,30H,8H2,(H,22,26)(H2,21,23,31)(H,27,28,29) |
| InChIKey | FHKSPWDCTWQSJD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|