C28H31F4N5O3S — CID 174556997
1-[3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)-2-pyridinyl]-4-(4-methylphenyl)piperazine (PubChem CID 174556997) has the molecular formula C28H31F4N5O3S and a molecular weight of 593.65 g/mol. Its IUPAC name is 1-[3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)-2-pyridinyl]-4-(4-methylphenyl)piperazine.
| Compound Name | 1-[3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)-2-pyridinyl]-4-(4-methylphenyl)piperazine |
|---|---|
| PubChem CID | 174556997 |
| Molecular Formula | C28H31F4N5O3S |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | 1-[3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)-2-pyridinyl]-4-(4-methylphenyl)piperazine |
| SMILES | Cc1ccc(N2CCN(c3nc(C(F)(F)F)ccc3CNC(=O)C(C)c3ccc(N(C)S(=O)O)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C28H31F4N5O3S/c1-18-4-8-22(9-5-18)36-12-14-37(15-13-36)26-21(7-11-25(34-26)28(30,31)32)17-33-27(38)19(2)20-6-10-24(23(29)16-20)35(3)41(39)40/h4-11,16,19H,12-15,17H2,1-3H3,(H,33,38)(H,39,40) |
| InChIKey | DXNBCOROVRXPRG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|