C22H28F3N3O4S — CID 174556965
2-butoxy-3-[[2-[3-methyl-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine (PubChem CID 174556965) has the molecular formula C22H28F3N3O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-butoxy-3-[[2-[3-methyl-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine.
| Compound Name | 2-butoxy-3-[[2-[3-methyl-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 174556965 |
| Molecular Formula | C22H28F3N3O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-butoxy-3-[[2-[3-methyl-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine |
| SMILES | CCCCOc1nc(C(F)(F)F)ccc1CNC(=O)C(C)c1ccc(N(C)S(=O)O)c(C)c1 |
| InChI | InChI=1S/C22H28F3N3O4S/c1-5-6-11-32-21-17(8-10-19(27-21)22(23,24)25)13-26-20(29)15(3)16-7-9-18(14(2)12-16)28(4)33(30)31/h7-10,12,15H,5-6,11,13H2,1-4H3,(H,26,29)(H,30,31) |
| InChIKey | GVKGTZHKIOMBRF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|