C26H34F4N3O4S- — CID 174571711
3-[[2-[3-fluoro-4-[methyl(sulfinato)amino]phenyl]propanoylamino]methyl]-2-nonan-5-yloxy-6-(trifluoromethyl)pyridine (PubChem CID 174571711) has the molecular formula C26H34F4N3O4S- and a molecular weight of 560.63 g/mol. Its IUPAC name is 3-[[2-[3-fluoro-4-[methyl(sulfinato)amino]phenyl]propanoylamino]methyl]-2-nonan-5-yloxy-6-(trifluoromethyl)pyridine.
| Compound Name | 3-[[2-[3-fluoro-4-[methyl(sulfinato)amino]phenyl]propanoylamino]methyl]-2-nonan-5-yloxy-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 174571711 |
| Molecular Formula | C26H34F4N3O4S- |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 3-[[2-[3-fluoro-4-[methyl(sulfinato)amino]phenyl]propanoylamino]methyl]-2-nonan-5-yloxy-6-(trifluoromethyl)pyridine |
| SMILES | CCCCC(CCCC)Oc1nc(C(F)(F)F)ccc1CNC(=O)C(C)c1ccc(N(C)S(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C26H35F4N3O4S/c1-5-7-9-20(10-8-6-2)37-25-19(12-14-23(32-25)26(28,29)30)16-31-24(34)17(3)18-11-13-22(21(27)15-18)33(4)38(35)36/h11-15,17,20H,5-10,16H2,1-4H3,(H,31,34)(H,35,36)/p-1 |
| InChIKey | YBHWZQONYNRDCR-UHFFFAOYSA-M |
| XLogP | 6.02 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|