C25H34F4N4O3S — CID 174556950
2-(dibutylamino)-3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine (PubChem CID 174556950) has the molecular formula C25H34F4N4O3S and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-(dibutylamino)-3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine.
| Compound Name | 2-(dibutylamino)-3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 174556950 |
| Molecular Formula | C25H34F4N4O3S |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 2-(dibutylamino)-3-[[2-[3-fluoro-4-[methyl(sulfino)amino]phenyl]propanoylamino]methyl]-6-(trifluoromethyl)pyridine |
| SMILES | CCCCN(CCCC)c1nc(C(F)(F)F)ccc1CNC(=O)C(C)c1ccc(N(C)S(=O)O)c(F)c1 |
| InChI | InChI=1S/C25H34F4N4O3S/c1-5-7-13-33(14-8-6-2)23-19(10-12-22(31-23)25(27,28)29)16-30-24(34)17(3)18-9-11-21(20(26)15-18)32(4)37(35)36/h9-12,15,17H,5-8,13-14,16H2,1-4H3,(H,30,34)(H,35,36) |
| InChIKey | QTPCEGTZILQWQC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|