C12H13F3N2O — CID 174557658
1-[2-methyl-4-(trifluoromethoxy)phenyl]butane-1,2-diimine (PubChem CID 174557658) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 1-[2-methyl-4-(trifluoromethoxy)phenyl]butane-1,2-diimine.
| Compound Name | 1-[2-methyl-4-(trifluoromethoxy)phenyl]butane-1,2-diimine |
|---|---|
| PubChem CID | 174557658 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-[2-methyl-4-(trifluoromethoxy)phenyl]butane-1,2-diimine |
| SMILES | [H]/N=C(C(\CC)=N\[H])/c1ccc(OC(F)(F)F)cc1C |
| InChI | InChI=1S/C12H13F3N2O/c1-3-10(16)11(17)9-5-4-8(6-7(9)2)18-12(13,14)15/h4-6,16-17H,3H2,1-2H3/b16-10+,17-11- |
| InChIKey | QARXPKIWXBQVNP-VUTUTYQISA-N |
| XLogP | 3.69 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|