C35H38F2N2O5 — CID 174559527
1,5-bis[(2,4-dimethoxyphenyl)methylamino]-2,4-bis(3-fluorophenyl)pentan-3-one (PubChem CID 174559527) has the molecular formula C35H38F2N2O5 and a molecular weight of 604.69 g/mol. Its IUPAC name is 1,5-bis[(2,4-dimethoxyphenyl)methylamino]-2,4-bis(3-fluorophenyl)pentan-3-one.
| Compound Name | 1,5-bis[(2,4-dimethoxyphenyl)methylamino]-2,4-bis(3-fluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 174559527 |
| Molecular Formula | C35H38F2N2O5 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 1,5-bis[(2,4-dimethoxyphenyl)methylamino]-2,4-bis(3-fluorophenyl)pentan-3-one |
| SMILES | COc1ccc(CNCC(C(=O)C(CNCc2ccc(OC)cc2OC)c2cccc(F)c2)c2cccc(F)c2)c(OC)c1 |
| InChI | InChI=1S/C35H38F2N2O5/c1-41-29-13-11-25(33(17-29)43-3)19-38-21-31(23-7-5-9-27(36)15-23)35(40)32(24-8-6-10-28(37)16-24)22-39-20-26-12-14-30(42-2)18-34(26)44-4/h5-18,31-32,38-39H,19-22H2,1-4H3 |
| InChIKey | BBUAZWYMATVZAK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |