About naphthalen-2-ylsulfinyl formate
naphthalen-2-ylsulfinyl formate (PubChem CID 174559983) has the molecular formula C11H8O3S
and a molecular weight of 220.25 g/mol. Its IUPAC name is naphthalen-2-ylsulfinyl formate.
Molecular Properties
| Compound Name | naphthalen-2-ylsulfinyl formate |
| PubChem CID | 174559983 |
| Molecular Formula | C11H8O3S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | naphthalen-2-ylsulfinyl formate |
| SMILES | O=COS(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O3S/c12-8-14-15(13)11-6-5-9-3-1-2-4-10(9)7-11/h1-8H |
| InChIKey | NAEDGZSQPNWMBT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ylsulfinyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylsulfinyl formate?
The IUPAC name of naphthalen-2-ylsulfinyl formate (CID 174559983) is naphthalen-2-ylsulfinyl formate.
What is the SMILES notation for naphthalen-2-ylsulfinyl formate?
The canonical SMILES for naphthalen-2-ylsulfinyl formate is O=COS(=O)c1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ylsulfinyl formate?
The InChIKey is NAEDGZSQPNWMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3S/c12-8-14-15(13)11-6-5-9-3-1-2-4-10(9)7-11/h1-8H.
What are the key properties of naphthalen-2-ylsulfinyl formate?
naphthalen-2-ylsulfinyl formate has a molecular weight of 220.25 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylsulfinyl formate is sourced from PubChem (CID 174559983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).