C12H13NOS — CID 139632027
N,N-dimethylnaphthalene-2-sulfinamide (PubChem CID 139632027) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is N,N-dimethylnaphthalene-2-sulfinamide.
| Compound Name | N,N-dimethylnaphthalene-2-sulfinamide |
|---|---|
| PubChem CID | 139632027 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N,N-dimethylnaphthalene-2-sulfinamide |
| SMILES | CN(C)S(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H13NOS/c1-13(2)15(14)12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,1-2H3 |
| InChIKey | GKBPJGFCCVLVAS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |