C18H25NO6 — CID 174562187
(2-methylpropan-2-yl)oxycarbonyl 2-amino-2-[4-(2-methyl-4-oxobutoxy)phenyl]acetate (PubChem CID 174562187) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 2-amino-2-[4-(2-methyl-4-oxobutoxy)phenyl]acetate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 2-amino-2-[4-(2-methyl-4-oxobutoxy)phenyl]acetate |
|---|---|
| PubChem CID | 174562187 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 2-amino-2-[4-(2-methyl-4-oxobutoxy)phenyl]acetate |
| SMILES | CC(CC=O)COc1ccc(C(N)C(=O)OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25NO6/c1-12(9-10-20)11-23-14-7-5-13(6-8-14)15(19)16(21)24-17(22)25-18(2,3)4/h5-8,10,12,15H,9,11,19H2,1-4H3 |
| InChIKey | NRUVCSASSDTLFG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|