C23H37NO8 — CID 174562395
4-amino-2-(2,3-dihydroxypropyl)benzoic acid;tridecanedioic acid (PubChem CID 174562395) has the molecular formula C23H37NO8 and a molecular weight of 455.55 g/mol. Its IUPAC name is 4-amino-2-(2,3-dihydroxypropyl)benzoic acid;tridecanedioic acid.
| Compound Name | 4-amino-2-(2,3-dihydroxypropyl)benzoic acid;tridecanedioic acid |
|---|---|
| PubChem CID | 174562395 |
| Molecular Formula | C23H37NO8 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 4-amino-2-(2,3-dihydroxypropyl)benzoic acid;tridecanedioic acid |
| SMILES | Nc1ccc(C(=O)O)c(CC(O)CO)c1.O=C(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H24O4.C10H13NO4/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17;11-7-1-2-9(10(14)15)6(3-7)4-8(13)5-12/h1-11H2,(H,14,15)(H,16,17);1-3,8,12-13H,4-5,11H2,(H,14,15) |
| InChIKey | LEBISNHDASOOBN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|