About azane;[bis(2-hydroxyethyl)amino] carbamodithioate
azane;[bis(2-hydroxyethyl)amino] carbamodithioate (PubChem CID 174562447) has the molecular formula C5H15N3O2S2
and a molecular weight of 213.33 g/mol. Its IUPAC name is azane;[bis(2-hydroxyethyl)amino] carbamodithioate.
Molecular Properties
| Compound Name | azane;[bis(2-hydroxyethyl)amino] carbamodithioate |
| PubChem CID | 174562447 |
| Molecular Formula | C5H15N3O2S2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | azane;[bis(2-hydroxyethyl)amino] carbamodithioate |
| SMILES | N.NC(=S)SN(CCO)CCO |
| InChI | InChI=1S/C5H12N2O2S2.H3N/c6-5(10)11-7(1-3-8)2-4-9;/h8-9H,1-4H2,(H2,6,10);1H3 |
| InChIKey | VKNYRFLSMOBEIA-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze azane;[bis(2-hydroxyethyl)amino] carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[bis(2-hydroxyethyl)amino] carbamodithioate?
The IUPAC name of azane;[bis(2-hydroxyethyl)amino] carbamodithioate (CID 174562447) is azane;[bis(2-hydroxyethyl)amino] carbamodithioate.
What is the SMILES notation for azane;[bis(2-hydroxyethyl)amino] carbamodithioate?
The canonical SMILES for azane;[bis(2-hydroxyethyl)amino] carbamodithioate is N.NC(=S)SN(CCO)CCO.
What is the InChIKey of azane;[bis(2-hydroxyethyl)amino] carbamodithioate?
The InChIKey is VKNYRFLSMOBEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2S2.H3N/c6-5(10)11-7(1-3-8)2-4-9;/h8-9H,1-4H2,(H2,6,10);1H3.
What are the key properties of azane;[bis(2-hydroxyethyl)amino] carbamodithioate?
azane;[bis(2-hydroxyethyl)amino] carbamodithioate has a molecular weight of 213.33 g/mol, XLogP of -0.67, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[bis(2-hydroxyethyl)amino] carbamodithioate is sourced from PubChem (CID 174562447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).