C15H20N4O4 — CID 174563386
N-[3-methyl-5-(2-oxo-5-phenylpentyl)-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 174563386) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[3-methyl-5-(2-oxo-5-phenylpentyl)-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | N-[3-methyl-5-(2-oxo-5-phenylpentyl)-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 174563386 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[3-methyl-5-(2-oxo-5-phenylpentyl)-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CN1COCN(CC(=O)CCCc2ccccc2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O4/c1-17-11-23-12-18(15(17)16-19(21)22)10-14(20)9-5-8-13-6-3-2-4-7-13/h2-4,6-7H,5,8-12H2,1H3 |
| InChIKey | BUMHGJWJWHXNOQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|