C5H11NOS2 — CID 174567821
S-(2-methyl-1,4-oxathian-2-yl)thiohydroxylamine (PubChem CID 174567821) has the molecular formula C5H11NOS2 and a molecular weight of 165.28 g/mol. Its IUPAC name is S-(2-methyl-1,4-oxathian-2-yl)thiohydroxylamine.
| Compound Name | S-(2-methyl-1,4-oxathian-2-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 174567821 |
| Molecular Formula | C5H11NOS2 |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | S-(2-methyl-1,4-oxathian-2-yl)thiohydroxylamine |
| SMILES | CC1(SN)CSCCO1 |
| InChI | InChI=1S/C5H11NOS2/c1-5(9-6)4-8-3-2-7-5/h2-4,6H2,1H3 |
| InChIKey | SJLIDRBZALKBFT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|