C6H12OS2 — CID 53230318
2-(2-methyl-1,3-oxathiolan-2-yl)ethanethiol (PubChem CID 53230318) has the molecular formula C6H12OS2 and a molecular weight of 164.29 g/mol. Its IUPAC name is 2-(2-methyl-1,3-oxathiolan-2-yl)ethanethiol.
| Compound Name | 2-(2-methyl-1,3-oxathiolan-2-yl)ethanethiol |
|---|---|
| PubChem CID | 53230318 |
| Molecular Formula | C6H12OS2 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 2-(2-methyl-1,3-oxathiolan-2-yl)ethanethiol |
| SMILES | CC1(CCS)OCCS1 |
| InChI | InChI=1S/C6H12OS2/c1-6(2-4-8)7-3-5-9-6/h8H,2-5H2,1H3 |
| InChIKey | VWBCXQCUAVKPLS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|