C27H34FN3O3 — CID 174569265
[2-[[4-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]methyl]-11,11-dimethyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl] acetate (PubChem CID 174569265) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is [2-[[4-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]methyl]-11,11-dimethyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl] acetate.
| Compound Name | [2-[[4-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]methyl]-11,11-dimethyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl] acetate |
|---|---|
| PubChem CID | 174569265 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | [2-[[4-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]methyl]-11,11-dimethyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl] acetate |
| SMILES | CC(=O)Oc1cc2c3c(c1)OCC(C)(C)N3C(CN1CCC(CCc3ccc(F)cc3)CC1)N2 |
| InChI | InChI=1S/C27H34FN3O3/c1-18(32)34-22-14-23-26-24(15-22)33-17-27(2,3)31(26)25(29-23)16-30-12-10-20(11-13-30)5-4-19-6-8-21(28)9-7-19/h6-9,14-15,20,25,29H,4-5,10-13,16-17H2,1-3H3 |
| InChIKey | RTMJIBOLWRVOAD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|