C15H15BrN2O2S — CID 174574951
3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-ethyl-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174574951) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-ethyl-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | 3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-ethyl-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174574951 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-ethyl-1,3-oxazolidine-2-carbaldehyde |
| SMILES | CCC1CN(c2nc(-c3ccc(Br)cc3)cs2)C(C=O)O1 |
| InChI | InChI=1S/C15H15BrN2O2S/c1-2-12-7-18(14(8-19)20-12)15-17-13(9-21-15)10-3-5-11(16)6-4-10/h3-6,8-9,12,14H,2,7H2,1H3 |
| InChIKey | NCDIAXRXBALGJJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|