C26H29N3O3 — CID 174575194
benzyl N-[2-[2-[3-[2-(aminomethyl)phenyl]propanoylamino]phenyl]ethyl]carbamate (PubChem CID 174575194) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is benzyl N-[2-[2-[3-[2-(aminomethyl)phenyl]propanoylamino]phenyl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[3-[2-(aminomethyl)phenyl]propanoylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 174575194 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | benzyl N-[2-[2-[3-[2-(aminomethyl)phenyl]propanoylamino]phenyl]ethyl]carbamate |
| SMILES | NCc1ccccc1CCC(=O)Nc1ccccc1CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O3/c27-18-23-12-5-4-10-21(23)14-15-25(30)29-24-13-7-6-11-22(24)16-17-28-26(31)32-19-20-8-2-1-3-9-20/h1-13H,14-19,27H2,(H,28,31)(H,29,30) |
| InChIKey | QQIWNCSLAOVYHB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |