About 2-methylhexanoic acid;thiophene
2-methylhexanoic acid;thiophene (PubChem CID 174580126) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-methylhexanoic acid;thiophene.
Molecular Properties
| Compound Name | 2-methylhexanoic acid;thiophene |
| PubChem CID | 174580126 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-methylhexanoic acid;thiophene |
| SMILES | CCCCC(C)C(=O)O.c1ccsc1 |
| InChI | InChI=1S/C7H14O2.C4H4S/c1-3-4-5-6(2)7(8)9;1-2-4-5-3-1/h6H,3-5H2,1-2H3,(H,8,9);1-4H |
| InChIKey | KYZYSESYESPZSE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylhexanoic acid;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexanoic acid;thiophene?
The IUPAC name of 2-methylhexanoic acid;thiophene (CID 174580126) is 2-methylhexanoic acid;thiophene.
What is the SMILES notation for 2-methylhexanoic acid;thiophene?
The canonical SMILES for 2-methylhexanoic acid;thiophene is CCCCC(C)C(=O)O.c1ccsc1.
What is the InChIKey of 2-methylhexanoic acid;thiophene?
The InChIKey is KYZYSESYESPZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C4H4S/c1-3-4-5-6(2)7(8)9;1-2-4-5-3-1/h6H,3-5H2,1-2H3,(H,8,9);1-4H.
What are the key properties of 2-methylhexanoic acid;thiophene?
2-methylhexanoic acid;thiophene has a molecular weight of 214.33 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexanoic acid;thiophene is sourced from PubChem (CID 174580126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).