About (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate
(2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate (PubChem CID 174581948) has the molecular formula C10H16N2O5
and a molecular weight of 244.25 g/mol. Its IUPAC name is (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate.
Molecular Properties
| Compound Name | (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate |
| PubChem CID | 174581948 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate |
| SMILES | CCC(=O)C(N)C(=O)OC(=O)C(N)C(=O)CC |
| InChI | InChI=1S/C10H16N2O5/c1-3-5(13)7(11)9(15)17-10(16)8(12)6(14)4-2/h7-8H,3-4,11-12H2,1-2H3 |
| InChIKey | QCONWORBMANEHH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate?
The IUPAC name of (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate (CID 174581948) is (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate.
What is the SMILES notation for (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate?
The canonical SMILES for (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate is CCC(=O)C(N)C(=O)OC(=O)C(N)C(=O)CC.
What is the InChIKey of (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate?
The InChIKey is QCONWORBMANEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O5/c1-3-5(13)7(11)9(15)17-10(16)8(12)6(14)4-2/h7-8H,3-4,11-12H2,1-2H3.
What are the key properties of (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate?
(2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate has a molecular weight of 244.25 g/mol, XLogP of -1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-oxopentanoyl) 2-amino-3-oxopentanoate is sourced from PubChem (CID 174581948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).