C28H39N5O2 — CID 174582026
N-[1-cyclohexyl-3-imino-4-[2-methyl-6-(2-methylphenyl)pyrimidin-4-yl]-2-oxohexyl]-2-(methylamino)propanamide (PubChem CID 174582026) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-imino-4-[2-methyl-6-(2-methylphenyl)pyrimidin-4-yl]-2-oxohexyl]-2-(methylamino)propanamide.
| Compound Name | N-[1-cyclohexyl-3-imino-4-[2-methyl-6-(2-methylphenyl)pyrimidin-4-yl]-2-oxohexyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 174582026 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | N-[1-cyclohexyl-3-imino-4-[2-methyl-6-(2-methylphenyl)pyrimidin-4-yl]-2-oxohexyl]-2-(methylamino)propanamide |
| SMILES | [H]/N=C(\C(=O)C(NC(=O)C(C)NC)C1CCCCC1)C(CC)c1cc(-c2ccccc2C)nc(C)n1 |
| InChI | InChI=1S/C28H39N5O2/c1-6-21(23-16-24(32-19(4)31-23)22-15-11-10-12-17(22)2)25(29)27(34)26(20-13-8-7-9-14-20)33-28(35)18(3)30-5/h10-12,15-16,18,20-21,26,29-30H,6-9,13-14H2,1-5H3,(H,33,35)/b29-25- |
| InChIKey | MXUORIMELKCFSR-GNVQSUKOSA-N |
| XLogP | 4.52 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|