C29H40N6O2 — CID 174597517
N-[1-cyclohexyl-4-[6-(2,3-dihydroindol-1-yl)-2-methylpyrimidin-4-yl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide (PubChem CID 174597517) has the molecular formula C29H40N6O2 and a molecular weight of 504.68 g/mol. Its IUPAC name is N-[1-cyclohexyl-4-[6-(2,3-dihydroindol-1-yl)-2-methylpyrimidin-4-yl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide.
| Compound Name | N-[1-cyclohexyl-4-[6-(2,3-dihydroindol-1-yl)-2-methylpyrimidin-4-yl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 174597517 |
| Molecular Formula | C29H40N6O2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | N-[1-cyclohexyl-4-[6-(2,3-dihydroindol-1-yl)-2-methylpyrimidin-4-yl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide |
| SMILES | [H]/N=C(\C(=O)C(NC(=O)C(C)NC)C1CCCCC1)C(CC)c1cc(N2CCc3ccccc32)nc(C)n1 |
| InChI | InChI=1S/C29H40N6O2/c1-5-22(23-17-25(33-19(3)32-23)35-16-15-20-11-9-10-14-24(20)35)26(30)28(36)27(21-12-7-6-8-13-21)34-29(37)18(2)31-4/h9-11,14,17-18,21-22,27,30-31H,5-8,12-13,15-16H2,1-4H3,(H,34,37)/b30-26- |
| InChIKey | XRKZTGOAWONIGU-BXVZCJGGSA-N |
| XLogP | 4.23 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|