C30H41N5O2 — CID 174581986
N-[1-cyclohexyl-4-[2-(3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide (PubChem CID 174581986) has the molecular formula C30H41N5O2 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[1-cyclohexyl-4-[2-(3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide.
| Compound Name | N-[1-cyclohexyl-4-[2-(3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 174581986 |
| Molecular Formula | C30H41N5O2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | N-[1-cyclohexyl-4-[2-(3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]-3-imino-2-oxohexyl]-2-(methylamino)propanamide |
| SMILES | [H]/N=C(\C(=O)C(NC(=O)C(C)NC)C1CCCCC1)C(CC)c1ccnc(N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C30H41N5O2/c1-4-24(23-16-17-33-26(19-23)35-18-10-14-21-11-8-9-15-25(21)35)27(31)29(36)28(22-12-6-5-7-13-22)34-30(37)20(2)32-3/h8-9,11,15-17,19-20,22,24,28,31-32H,4-7,10,12-14,18H2,1-3H3,(H,34,37)/b31-27- |
| InChIKey | FVZAPELSTHQDTN-QVTSOHHYSA-N |
| XLogP | 4.92 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|